cas: 77611-37-1 — see every product listed under this CAS number, including other names
Boc-6-OH-Nle-OH 95% (CAS 77611-37-1) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A139086-100g |
| cas | 77611-37-1 |
| size | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 16262.44 Pln | |
| Ambeed | 100mg | 142.31 Pln | |
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 370.38 Pln | |
| Ambeed | 5g | 1555.19 Pln | |
| Ambeed | 25g | 5131.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A139086 |
(2S)-6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 77611-37-1) is a chemical compound with the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. IUPAC name: (2S)-6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: BRFDKSWARKFUGQ-QMMMGPOBSA-N.
| Molecular formula | C11H21NO5 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | (2S)-6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | BRFDKSWARKFUGQ-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCO)C(=O)O |
Computed by PubChem (NCBI)