Boc-Ac5c-OH 95%
cas: 35264-09-6 — see every product listed under this CAS number, including other names
Boc-Ac5c-OH 95% (CAS 35264-09-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A274768-1g |
| cas | 35264-09-6 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 10g | 203.50 Pln | |
| Ambeed | 25g | 403.75 Pln | |
| Ambeed | 100g | 1405.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A274768 |
1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid (CAS 35264-09-6) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid. InChIKey: YBZCSKVLXBOFSL-UHFFFAOYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
| InChIKey | YBZCSKVLXBOFSL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CCCC1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1-tert-butoxycarbonylaminocyclopentanecarboxylic acid, Boc-cycloleucine, 1-(Boc-amino)cyclopentanecarboxylic acid, 1-((tert-Butoxycarbonyl)amino)cyclopentanecarboxylic acid, 1-N-Boc-Aminocyclopentanecarboxylic acid, Boc-1-aminocyclopentane-1-carboxylic acid, 1-(tert-Butoxycarbonylamino)cyclopentanecarboxylic Acid, N-Boc-cycloleucine, 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic Acid, 1-((tert-butoxycarbonyl)amino)cyclopentane-1-carboxylic acid