Boc-Ala-OMe, 95%
cas: 28875-17-4 — see every product listed under this CAS number, including other names
Boc-Ala-OMe, 95% (CAS 28875-17-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 50g, 250g, 1kg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A329488-5g |
| cas | 28875-17-4 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 125.62 Pln | |
| Ambeed | 10g | 142.31 Pln | |
| Ambeed | 25g | 164.56 Pln | |
| Ambeed | 100g | 303.62 Pln | |
| Ambeed | 500g | 1227.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 98.00 Pln | |
| Chemat | 50g | 126.80 Pln | |
| Chemat | 100g | 184.40 Pln | |
| Chemat | 250g | 357.20 Pln | |
| Chemat | 500g | 720.00 Pln | |
| Chemat | 1kg | 1283.60 Pln | |
| BLDpharm | 5g | 125.54 Pln | |
| BLDpharm | 10g | 147.75 Pln | |
| BLDpharm | 25g | 169.96 Pln | |
| BLDpharm | 100g | 319.91 Pln | |
| BLDpharm | 500g | 1319.56 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 28875-17-4) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: GJDICGOCZGRDFM-LURJTMIESA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | GJDICGOCZGRDFM-LURJTMIESA-N |
| SMILES | C[C@@H](C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Boc-L-alanine methyl ester, Boc-Ala-OMe, L-Alanine, N-[(1,1-dimethylethoxy)carbonyl]-, methyl ester, N-Boc-L-alanine Methyl Ester, (S)-N-tert-Butoxycarbonylalanine methyl ester, (S)-methyl 2-(tert-butoxycarbonylamino)propanoate, methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate, N-tert-Butoxycarbonylalanine Methyl Ester, methyl N-(tert-butoxycarbonyl)-L-alaninate, Methyl (tert-butoxycarbonyl)-L-alaninate
