CAS 132696-45-8 appears in our catalog under these names: (R)-3-(Boc-amino)-2-methylpropionic acid, 97%, (R)-3-((tertButoxycarbonyl)amino)-2-methylpropanoic Acid, (R)–3–(Boc–amino)–2–methylpropionic acid, Boc-R-AMPA-OH, (R)-3-(Boc-amino)-2-methylpropionic acid, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, Iris Biotech, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg, 50mg, 10g.
(2R)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 132696-45-8) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: (2R)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: GDQRNRYMFXDGMS-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (2R)-2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | GDQRNRYMFXDGMS-ZCFIWIBFSA-N |
| SMILES | C[C@H](CNC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)