CAS 45125-00-6 appears in our catalog under these names: H-D-Glu(otbu)-oh, 98%, H–D–Glu(OtBu)–OH, H-D-Glu(OtBu)-OH, D-Glutamic acid 5-tert-butyl ester, 95% , H-D-Glu(OtBu)-OH, 97%, 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 25g, 100g, 5g, 1g, 10g.
(2R)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (CAS 45125-00-6) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: (2R)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid. InChIKey: OIOAKXPMBIZAHL-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (2R)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| InChIKey | OIOAKXPMBIZAHL-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@H](C(=O)O)N |
Computed by PubChem (NCBI)