cas: 91103-47-8 — see every product listed under this CAS number, including other names
Boc-D-Ala-OMe 97% (CAS 91103-47-8) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A422757-1000g |
| cas | 91103-47-8 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 2662.12 Pln | |
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 164.56 Pln | |
| Ambeed | 100g | 392.62 Pln | |
| Ambeed | 500g | 1688.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A422757 |
Methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 91103-47-8) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: GJDICGOCZGRDFM-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | GJDICGOCZGRDFM-ZCFIWIBFSA-N |
| SMILES | C[C@H](C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)