cas: 65710-57-8 — see every product listed under this CAS number, including other names
Boc-Dap(Cbz)-OH 97% (CAS 65710-57-8) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A253941-1000g |
| cas | 65710-57-8 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 3585.50 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 175.69 Pln | |
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 509.44 Pln | |
| Ambeed | 500g | 2267.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A253941 |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(phenylmethoxycarbonylamino)propanoic acid (CAS 65710-57-8) is a chemical compound with the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: QKMSMVGTLTVHLK-LBPRGKRZSA-N.
| Molecular formula | C16H22N2O6 |
|---|---|
| Molecular weight | 338.36 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | QKMSMVGTLTVHLK-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CNC(=O)OCC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)