cas: 65710-57-8 — see every product listed under this CAS number, including other names
Boc-Dap(Z)-OH, 98%, 98% (CAS 65710-57-8) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 5kg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FAYE-1kg |
| cas | 65710-57-8 |
| size | 1kg |
| availability | 5000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 2978.00 Pln | |
| Chemat | 5kg | 14126.40 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 117.20 Pln | |
| Chemat | 25g | 184.40 Pln | |
| Chemat | 50g | 304.40 Pln | |
| Chemat | 100g | 462.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(phenylmethoxycarbonylamino)propanoic acid (CAS 65710-57-8) is a chemical compound with the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: QKMSMVGTLTVHLK-LBPRGKRZSA-N.
| Molecular formula | C16H22N2O6 |
|---|---|
| Molecular weight | 338.36 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | QKMSMVGTLTVHLK-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CNC(=O)OCC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)