cas: 2488-15-5 — see every product listed under this CAS number, including other names
Boc-Met-OH, 97% (CAS 2488-15-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A118578-5g |
| cas | 2488-15-5 |
| size | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 225.75 Pln | |
| Ambeed | 25g | 209.06 Pln | |
| Ambeed | 100g | 375.94 Pln | |
| Ambeed | 500g | 1599.69 Pln | |
| BLDpharm | 5g | 186.63 Pln | |
| BLDpharm | 10g | 208.84 Pln | |
| BLDpharm | 25g | 236.61 Pln | |
| BLDpharm | 100g | 403.22 Pln | |
| BLDpharm | 500g | 1719.42 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoic acid (CAS 2488-15-5) is a chemical compound with the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoic acid. InChIKey: IMUSLIHRIYOHEV-ZETCQYMHSA-N.
| Molecular formula | C10H19NO4S |
|---|---|
| Molecular weight | 249.33 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoic acid |
| InChIKey | IMUSLIHRIYOHEV-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCSC)C(=O)O |
Computed by PubChem (NCBI)