CAS 93000-03-4 appears in our catalog under these names: Boc–DL–Met–OH, Boc-DL-Met-OH 97%, Boc-DL-Met-OH, 97%, 97%, (tert-Butoxycarbonyl)methionine, 95.0%, Boc-DL-methionine, 95%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100g, 25g, 500g, 5g, 10g, 1g, 100 g, 500 g.
2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoic acid (CAS 93000-03-4) is a chemical compound with the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoic acid. InChIKey: IMUSLIHRIYOHEV-UHFFFAOYSA-N.
| Molecular formula | C10H19NO4S |
|---|---|
| Molecular weight | 249.33 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoic acid |
| InChIKey | IMUSLIHRIYOHEV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCSC)C(=O)O |
Computed by PubChem (NCBI)