Boc-NH-PEG2-CH2CH2COOH, 98.0%
cas: 1365655-91-9 — see every product listed under this CAS number, including other names
Boc-NH-PEG2-CH2CH2COOH, 98.0% (CAS 1365655-91-9) is a chemical reagent available from Chemat. Available pack sizes: 100 mg, 25 g, 1 g, 5 g, 10 g, 500 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W025812-100 mg |
| cas | 1365655-91-9 |
| size | 100 mg |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 mg | 263.96 Pln | |
| MedChemExpress | 25 g | 2544.17 Pln | |
| MedChemExpress | 1 g | 505.45 Pln | |
| MedChemExpress | 5 g | 886.26 Pln | |
| MedChemExpress | 10 g | 1318.15 Pln | |
| MedChemExpress | 500 mg | 407.93 Pln |
properties
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.0% |
3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoic acid (CAS 1365655-91-9) is a chemical compound with the molecular formula C12H23NO6 and a molecular weight of 277.31 g/mol. IUPAC name: 3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoic acid. InChIKey: OZMXZVCAXAQCHJ-UHFFFAOYSA-N.
| Molecular formula | C12H23NO6 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | 3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoic acid |
| InChIKey | OZMXZVCAXAQCHJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
13,13-Dimethyl-11-oxo-4,7,12-trioxa-10-azatetradecanoic acid, 3-[2-(2-([(tert-Butoxy)carbonyl]amino)ethoxy)ethoxy]propanoic acid, 3-[2-(2-{[(tert-butoxy)carbonyl]amino}ethoxy)ethoxy]propanoic acid, 3-(2-(2-(((tert-butoxy)carbonyl)amino)ethoxy)ethoxy)propanoic acid, t-Boc-N-amido-PEG2-acid, N-Boc-3-[2-(2-aminoethoxy)ethoxy]propionic acid, Boc-NH-PEG2-CH2CH2COOH, 2,2-dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid, 4,7,12-Trioxa-10-azatetradecanoic acid, 13,13-dimethyl-11-oxo-, BocNH-PEG2-CH2CH2COOH