cas: 1365655-91-9 — see every product listed under this CAS number, including other names
N-Boc-3-[2-(2-aminoethoxy)ethoxy]propionic Acid, 95%, 95% (CAS 1365655-91-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11233Y-100mg |
| cas | 1365655-91-9 |
| size | 100mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 290.00 Pln | |
| Chemat | 10g | 496.40 Pln | |
| Chemat | 25g | 1062.80 Pln | |
| Chemat | 100g | 3131.60 Pln | |
| Chemat | 50g | 1830.80 Pln | |
| Chemat | 250g | 5589.20 Pln | |
| Chemat | 500g | 8985.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoic acid (CAS 1365655-91-9) is a chemical compound with the molecular formula C12H23NO6 and a molecular weight of 277.31 g/mol. IUPAC name: 3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoic acid. InChIKey: OZMXZVCAXAQCHJ-UHFFFAOYSA-N.
| Molecular formula | C12H23NO6 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | 3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoic acid |
| InChIKey | OZMXZVCAXAQCHJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)