cas: 1365655-91-9 — see every product listed under this CAS number, including other names
T-BOC-N-AMIDO-PEG2-ACID, 95% (CAS 1365655-91-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F533570-100MG |
| cas | 1365655-91-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 112.48 Pln | |
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 445.69 Pln | |
| Fluorochem | 10g | 794.53 Pln | |
| Fluorochem | 25g | 1601.54 Pln | |
| Fluorochem | 100g | 4173.55 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoic acid (CAS 1365655-91-9) is a chemical compound with the molecular formula C12H23NO6 and a molecular weight of 277.31 g/mol. IUPAC name: 3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoic acid. InChIKey: OZMXZVCAXAQCHJ-UHFFFAOYSA-N.
| Molecular formula | C12H23NO6 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | 3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoic acid |
| InChIKey | OZMXZVCAXAQCHJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)