cas: 1365655-91-9 — see every product listed under this CAS number, including other names
Boc-NH-PEG2-acid, >95.0%(HPLC) (CAS 1365655-91-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D5825-250MG |
| cas | 1365655-91-9 |
| size | 250mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 250mg | 665.65 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(HPLC) |
3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoic acid (CAS 1365655-91-9) is a chemical compound with the molecular formula C12H23NO6 and a molecular weight of 277.31 g/mol. IUPAC name: 3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoic acid. InChIKey: OZMXZVCAXAQCHJ-UHFFFAOYSA-N.
| Molecular formula | C12H23NO6 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | 3-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]propanoic acid |
| InChIKey | OZMXZVCAXAQCHJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)