cas: 13734-40-2 — see every product listed under this CAS number, including other names
Boc-O-tert-butyl-L-threonine, 97%, 97% (CAS 13734-40-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149AO-1g |
| cas | 13734-40-2 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 146.00 Pln | |
| Chemat | 100g | 405.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S,3R)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 13734-40-2) is a chemical compound with the molecular formula C13H25NO5 and a molecular weight of 275.34 g/mol. IUPAC name: (2S,3R)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: LKRXXARJBFBMCE-BDAKNGLRSA-N.
| Molecular formula | C13H25NO5 |
|---|---|
| Molecular weight | 275.34 g/mol |
| IUPAC name | (2S,3R)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | LKRXXARJBFBMCE-BDAKNGLRSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)OC(C)(C)C)OC(C)(C)C |
Computed by PubChem (NCBI)