cas: 13734-40-2 — see every product listed under this CAS number, including other names
Boc-Thr(tBu)-OH, 98.0% (CAS 13734-40-2) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W011606-25 g |
| cas | 13734-40-2 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 287.18 Pln | |
| MedChemExpress | 100 g | 788.74 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
(2S,3R)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 13734-40-2) is a chemical compound with the molecular formula C13H25NO5 and a molecular weight of 275.34 g/mol. IUPAC name: (2S,3R)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: LKRXXARJBFBMCE-BDAKNGLRSA-N.
| Molecular formula | C13H25NO5 |
|---|---|
| Molecular weight | 275.34 g/mol |
| IUPAC name | (2S,3R)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | LKRXXARJBFBMCE-BDAKNGLRSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)OC(C)(C)C)OC(C)(C)C |
Computed by PubChem (NCBI)