cas: 41153-30-4 — see every product listed under this CAS number, including other names
Boc-Phe(4-F)-OH, 98%, 98% (CAS 41153-30-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 250mg, 1g, 5g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I92X-10g |
| cas | 41153-30-4 |
| size | 10g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 194.00 Pln | |
| Chemat | 25g | 395.60 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 100g | 1389.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 41153-30-4) is a chemical compound with the molecular formula C14H18FNO4 and a molecular weight of 283.29 g/mol. IUPAC name: (2S)-3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RCXSXRAUMLKRRL-NSHDSACASA-N.
| Molecular formula | C14H18FNO4 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | (2S)-3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RCXSXRAUMLKRRL-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)F)C(=O)O |
Computed by PubChem (NCBI)