cas: 41153-30-4 — see every product listed under this CAS number, including other names
Boc-L-4-fluorophenylalanine, 98% (CAS 41153-30-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F008080-1G |
| cas | 41153-30-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 10g | 258.26 Pln | |
| Fluorochem | 25g | 518.59 Pln | |
| Fluorochem | 100g | 1893.10 Pln | |
| Fluorochem | 250g | 4652.55 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 41153-30-4) is a chemical compound with the molecular formula C14H18FNO4 and a molecular weight of 283.29 g/mol. IUPAC name: (2S)-3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RCXSXRAUMLKRRL-NSHDSACASA-N.
| Molecular formula | C14H18FNO4 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | (2S)-3-(4-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RCXSXRAUMLKRRL-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)F)C(=O)O |
Computed by PubChem (NCBI)