cas: 1311182-82-7 — see every product listed under this CAS number, including other names
Boronic acid, B-[3-[(4-methylphenyl)methoxy]phenyl]-, 95%, 95% (CAS 1311182-82-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FKZF-250mg |
| cas | 1311182-82-7 |
| size | 250mg |
| availability | 7.85g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1782.80 Pln | |
| Chemat | 5g | 5229.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[3-[(4-methylphenyl)methoxy]phenyl]boronic acid (CAS 1311182-82-7) is a chemical compound with the molecular formula C14H15BO3 and a molecular weight of 242.08 g/mol. IUPAC name: [3-[(4-methylphenyl)methoxy]phenyl]boronic acid. InChIKey: WZSJTVTUCVQERB-UHFFFAOYSA-N.
| Molecular formula | C14H15BO3 |
|---|---|
| Molecular weight | 242.08 g/mol |
| IUPAC name | [3-[(4-methylphenyl)methoxy]phenyl]boronic acid |
| InChIKey | WZSJTVTUCVQERB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OCC2=CC=C(C=C2)C)(O)O |
Computed by PubChem (NCBI)