cas: 685514-79-8 — see every product listed under this CAS number, including other names
CHROMAN-8-BORONIC ACID, 95%, 95% (CAS 685514-79-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FM7R-100mg |
| cas | 685514-79-8 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 309.20 Pln | |
| Chemat | 1g | 712.40 Pln | |
| Chemat | 5g | 3323.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3,4-dihydro-2H-chromen-8-ylboronic acid (CAS 685514-79-8) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: 3,4-dihydro-2H-chromen-8-ylboronic acid. InChIKey: LUKDZQONQZOKEA-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | 3,4-dihydro-2H-chromen-8-ylboronic acid |
| InChIKey | LUKDZQONQZOKEA-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)CCCO2)(O)O |
Computed by PubChem (NCBI)