cas: 685514-79-8 — see every product listed under this CAS number, including other names
Chroman-8-ylboronic acid, 95% (CAS 685514-79-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F619193-100MG |
| cas | 685514-79-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 232.23 Pln | |
| Fluorochem | 250mg | 383.22 Pln | |
| Fluorochem | 1g | 940.31 Pln | |
| Fluorochem | 5g | 3663.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3,4-dihydro-2H-chromen-8-ylboronic acid (CAS 685514-79-8) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: 3,4-dihydro-2H-chromen-8-ylboronic acid. InChIKey: LUKDZQONQZOKEA-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | 3,4-dihydro-2H-chromen-8-ylboronic acid |
| InChIKey | LUKDZQONQZOKEA-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)CCCO2)(O)O |
Computed by PubChem (NCBI)