cas: 57266-55-4 — see every product listed under this CAS number, including other names
CIS-2-AMINOCYCLOHEXANE-1-CARBOXYLIC ACID HCL, 95% (CAS 57266-55-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F527562-100MG |
| cas | 57266-55-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 195.78 Pln | |
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 1153.78 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Cis-(1S,2R)-2-aminocyclohexane-1-carboxylic acid;hydrochloride (CAS 57266-55-4) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: cis-(1S,2R)-2-aminocyclohexane-1-carboxylic acid;hydrochloride. InChIKey: QNIOBHOEZYKCJV-RIHPBJNCSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | cis-(1S,2R)-2-aminocyclohexane-1-carboxylic acid;hydrochloride |
| InChIKey | QNIOBHOEZYKCJV-RIHPBJNCSA-N |
| SMILES | C1CC[C@H]([C@H](C1)C(=O)O)N.Cl |
Computed by PubChem (NCBI)