cis-2-Aminocyclohexanecarboxylic acid hydrochloride, 95%
cas: 57266-55-4 — see every product listed under this CAS number, including other names
cis-2-Aminocyclohexanecarboxylic acid hydrochloride, 95% (CAS 57266-55-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A861216-250mg |
| cas | 57266-55-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 509.44 Pln | |
| Ambeed | 1g | 1060.12 Pln | |
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 664.40 Pln | |
| BLDpharm | 100mg | 275.48 Pln | |
| BLDpharm | 250mg | 542.06 Pln | |
| BLDpharm | 1g | 1136.29 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Cis-(1S,2R)-2-aminocyclohexane-1-carboxylic acid;hydrochloride (CAS 57266-55-4) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: cis-(1S,2R)-2-aminocyclohexane-1-carboxylic acid;hydrochloride. InChIKey: QNIOBHOEZYKCJV-RIHPBJNCSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | cis-(1S,2R)-2-aminocyclohexane-1-carboxylic acid;hydrochloride |
| InChIKey | QNIOBHOEZYKCJV-RIHPBJNCSA-N |
| SMILES | C1CC[C@H]([C@H](C1)C(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(1S,2R)-2-aminocyclohexane-1-carboxylic acid hydrochloride, rac-(1R,2S)-2-aminocyclohexane-1-carboxylic acid hydrochloride, (1S,2R)-2-aminocyclohexanecarboxylic acid hydrochloride, (1S,2R)-2-aminocyclohexanecarboxylic acid;hydrochloride, (1S,2R)-2-aminocyclohexanecarboxylic acid HCl, cis-2-aminocyclohexanecarboxylic acid;hydrochloride, (1S,2R)-2-aminocyclohexane-1-carboxylic acid;hydrochloride, (+/-)-cis-2-Aminocyclohexane-1-carboxylic acid hydrochloride, (1S,2R)-2-aminocyclohexan, (1S,2R)-2-Aminocyclohexanecarboxylicacidhydrochloride