Products 1026249-18-2
CAS 1026249-18-2 appears in our catalog under these names: CL097/ 99.57% (existing batch purity), CL097, CL097, 99.88% ,, 99.88% ,, CL097, 99.90%, CL097 (Standard). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 5 mg.
2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine (CAS 1026249-18-2) is a chemical compound with the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. IUPAC name: 2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine. InChIKey: DEVCLHVFELRPIU-UHFFFAOYSA-N.
| Molecular formula | C13H14N4O |
|---|---|
| Molecular weight | 242.28 g/mol |
| IUPAC name | 2-(ethoxymethyl)-3H-imidazo[4,5-c]quinolin-4-amine |
| InChIKey | DEVCLHVFELRPIU-UHFFFAOYSA-N |
| SMILES | CCOCC1=NC2=C(N1)C(=NC3=CC=CC=C32)N |
Computed by PubChem (NCBI)