cas: 2037-95-8 — see every product listed under this CAS number, including other names
Carsalam 98% (CAS 2037-95-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A163371-25mg |
| cas | 2037-95-8 |
| size | 25mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 120.06 Pln | |
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 231.31 Pln | |
| Ambeed | 100g | 565.06 Pln | |
| Ambeed | 500g | 1799.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A163371 |
1,3-benzoxazine-2,4-dione (CAS 2037-95-8) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 1,3-benzoxazine-2,4-dione. InChIKey: OAYRYNVEFFWSHK-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 1,3-benzoxazine-2,4-dione |
| InChIKey | OAYRYNVEFFWSHK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC(=O)O2 |
Computed by PubChem (NCBI)