CAS 2037-95-8 appears in our catalog under these names: Salcaprozate Impurity 9, Carsalam/ 99.84% (existing batch purity), 2H-Benzo[e][1,3]oxazine-2,4(3H)-dione, >95.0%(HPLC)(T), 2H-1,3-Benzoxazine-2,4(3H)-dione, Carsalam 98%. Offered by: Chemat Brand, TargetMol, TCI, Biosynth, Ambeed. Available pack sizes: on request, 1g, 100mg, 200mg, 500mg, 25g, 100g, 0,25kg.
1,3-benzoxazine-2,4-dione (CAS 2037-95-8) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: 1,3-benzoxazine-2,4-dione. InChIKey: OAYRYNVEFFWSHK-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 1,3-benzoxazine-2,4-dione |
| InChIKey | OAYRYNVEFFWSHK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC(=O)O2 |
Computed by PubChem (NCBI)