cas: 4668-42-2 — see every product listed under this CAS number, including other names
Cbz-Asp-OMe 98% (CAS 4668-42-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A171264-1g |
| cas | 4668-42-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 25g | 186.81 Pln | |
| Ambeed | 100g | 437.12 Pln | |
| Ambeed | 500g | 1850.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A171264 |
(3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid (CAS 4668-42-2) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: MFFFBNAPQRDRQW-JTQLQIEISA-N.
| Molecular formula | C13H15NO6 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | MFFFBNAPQRDRQW-JTQLQIEISA-N |
| SMILES | COC(=O)[C@H](CC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)