CAS 335153-21-4 appears in our catalog under these names: 2-(2-Formyl-4-Nitrophenoxy)-Hexanoic Acid, 2-(2'-Formyl-4'-nitrophenoxy)caproic Acid, 2-(2-Formyl-4-nitrophenoxy)hexanoic acid, 98%, 2-(2-Formyl-4-nitrophenoxy)hexanoic acid, 95%, 95%. Offered by: Chemat Brand, TRC, Fluorochem, Chemat. Available pack sizes: on request, 2,5g, 100mg, 250mg, 1g.
2-(2-formyl-4-nitrophenoxy)hexanoic acid (CAS 335153-21-4) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: 2-(2-formyl-4-nitrophenoxy)hexanoic acid. InChIKey: BQZBIATZHUXDFL-UHFFFAOYSA-N.
| Molecular formula | C13H15NO6 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | 2-(2-formyl-4-nitrophenoxy)hexanoic acid |
| InChIKey | BQZBIATZHUXDFL-UHFFFAOYSA-N |
| SMILES | CCCCC(C(=O)O)OC1=C(C=C(C=C1)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)