cas: 4668-42-2 — see every product listed under this CAS number, including other names
Z-Asp-OMe, 98% (CAS 4668-42-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M03042-1G |
| cas | 4668-42-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 25g | 164.54 Pln | |
| Fluorochem | 100g | 419.66 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid (CAS 4668-42-2) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: MFFFBNAPQRDRQW-JTQLQIEISA-N.
| Molecular formula | C13H15NO6 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | MFFFBNAPQRDRQW-JTQLQIEISA-N |
| SMILES | COC(=O)[C@H](CC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)