CAS 63648-73-7 appears in our catalog under these names: N-Cbz-D-glutamic Acid, Z–D–Glu–OH, Z-D-Glu-OH, N-Benzyloxycarbonyl-D-glutamic acid, 95% , N-Carbobenzoxy-D-glutamic Acid, >98.0%(T). Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 10g, 50g, 100g, 25g, 5g, 1g, 25 g, 100 g.
(2R)-2-(phenylmethoxycarbonylamino)pentanedioic acid (CAS 63648-73-7) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: (2R)-2-(phenylmethoxycarbonylamino)pentanedioic acid. InChIKey: PVFCXMDXBIEMQG-SNVBAGLBSA-N.
| Molecular formula | C13H15NO6 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | (2R)-2-(phenylmethoxycarbonylamino)pentanedioic acid |
| InChIKey | PVFCXMDXBIEMQG-SNVBAGLBSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)