CAS 1383786-28-4 appears in our catalog under these names: Methyl 2-(1,3-dimethoxy-1,3-dioxopropan-2-yl)-5-aminobenzoate, Nintedanib Impurity 82. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Dimethyl 2-(4-amino-2-methoxycarbonylphenyl)propanedioate (CAS 1383786-28-4) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: dimethyl 2-(4-amino-2-methoxycarbonylphenyl)propanedioate. InChIKey: PEWVRFAEUMPCKY-UHFFFAOYSA-N.
| Molecular formula | C13H15NO6 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | dimethyl 2-(4-amino-2-methoxycarbonylphenyl)propanedioate |
| InChIKey | PEWVRFAEUMPCKY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)N)C(C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)