CAS 3160-47-2 appears in our catalog under these names: Z–Asp(OMe)–OH, Z-Asp(OMe)-OH, N-Benzyloxycarbonyl-L-aspartic acid 4-methyl ester, 98% , Z-Asp(OMe)-OH, 97%, 97%, Z-Asp(OMe)-OH, 99.71%. Offered by: GLPBio, TargetMol, Thermo Scientific (Alfa Aesar), Chemat, MedChemExpress. Available pack sizes: 100g, 25g, 10mg, 25mg, 100mg, 5g, 1g, 10g.
(2S)-4-methoxy-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 3160-47-2) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: (2S)-4-methoxy-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: PHMBNDDHIBIDRQ-JTQLQIEISA-N.
| Molecular formula | C13H15NO6 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | (2S)-4-methoxy-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | PHMBNDDHIBIDRQ-JTQLQIEISA-N |
| SMILES | COC(=O)C[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)