CAS 47087-37-6 appears in our catalog under these names: Cbz-D-Asp-OMe 97%, Z-D-Asp-OMe, 97%, 97%, z-d-asp-ome, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
(3R)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid (CAS 47087-37-6) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: (3R)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: MFFFBNAPQRDRQW-SNVBAGLBSA-N.
| Molecular formula | C13H15NO6 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | (3R)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | MFFFBNAPQRDRQW-SNVBAGLBSA-N |
| SMILES | COC(=O)[C@@H](CC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)