Products 5183-91-5
CAS 5183-91-5 is the registry number for ((Benzyloxy)carbonyl)-D-prolyl-D-proline. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2R)-1-[(2R)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid (CAS 5183-91-5) is a chemical compound with the molecular formula C18H22N2O5 and a molecular weight of 346.4 g/mol. IUPAC name: (2R)-1-[(2R)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid. InChIKey: GEAZFVPWHCGNLW-HUUCEWRRSA-N.
| Molecular formula | C18H22N2O5 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | (2R)-1-[(2R)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | GEAZFVPWHCGNLW-HUUCEWRRSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)[C@H]2CCCN2C(=O)OCC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)