Products 1867108-30-2
CAS 1867108-30-2 appears in our catalog under these names: 1-[(Phenylmethoxy)carbonyl]-L-prolyl-D-proline, 95%, 95%, Cbz-Pro-D-Pro-OH, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2R)-1-[(2S)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid (CAS 1867108-30-2) is a chemical compound with the molecular formula C18H22N2O5 and a molecular weight of 346.4 g/mol. IUPAC name: (2R)-1-[(2S)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid. InChIKey: GEAZFVPWHCGNLW-LSDHHAIUSA-N.
| Molecular formula | C18H22N2O5 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | (2R)-1-[(2S)-1-phenylmethoxycarbonylpyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | GEAZFVPWHCGNLW-LSDHHAIUSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)[C@@H]2CCCN2C(=O)OCC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)