cas: 62937-47-7 — see every product listed under this CAS number, including other names
Cbz-D-Pro-NH2 97% (CAS 62937-47-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A208962-250mg |
| cas | 62937-47-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 804.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A208962 |
Benzyl (2R)-2-carbamoylpyrrolidine-1-carboxylate (CAS 62937-47-7) is a chemical compound with the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. IUPAC name: benzyl (2R)-2-carbamoylpyrrolidine-1-carboxylate. InChIKey: ZCGHEBMEQXMRQL-LLVKDONJSA-N.
| Molecular formula | C13H16N2O3 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | benzyl (2R)-2-carbamoylpyrrolidine-1-carboxylate |
| InChIKey | ZCGHEBMEQXMRQL-LLVKDONJSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)OCC2=CC=CC=C2)C(=O)N |
Computed by PubChem (NCBI)