cas: 62937-47-7 — see every product listed under this CAS number, including other names
Z-D-Pro-Nh2, 97%, 97% (CAS 62937-47-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EAOA-250mg |
| cas | 62937-47-7 |
| size | 250mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 323.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl (2R)-2-carbamoylpyrrolidine-1-carboxylate (CAS 62937-47-7) is a chemical compound with the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. IUPAC name: benzyl (2R)-2-carbamoylpyrrolidine-1-carboxylate. InChIKey: ZCGHEBMEQXMRQL-LLVKDONJSA-N.
| Molecular formula | C13H16N2O3 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | benzyl (2R)-2-carbamoylpyrrolidine-1-carboxylate |
| InChIKey | ZCGHEBMEQXMRQL-LLVKDONJSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)OCC2=CC=CC=C2)C(=O)N |
Computed by PubChem (NCBI)