cas: 29880-22-6 — see every product listed under this CAS number, including other names
Cbz-DL-Asn-OH 98.0% (CAS 29880-22-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A799871-1g |
| cas | 29880-22-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 192.38 Pln | |
| Ambeed | 25g | 437.12 Pln | |
| Ambeed | 100g | 1371.62 Pln | |
| Ambeed | 500g | 4614.56 Pln |
| purity | 98.0% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A799871 |
4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 29880-22-6) is a chemical compound with the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. IUPAC name: 4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: FUCKRCGERFLLHP-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O5 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | FUCKRCGERFLLHP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC(CC(=O)N)C(=O)O |
Computed by PubChem (NCBI)