cas: 1145-81-9 — see every product listed under this CAS number, including other names
Cbz-Gly-OEt 97% (CAS 1145-81-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A154211-250mg |
| cas | 1145-81-9 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 186.81 Pln | |
| Ambeed | 25g | 337.00 Pln | |
| Ambeed | 100g | 987.81 Pln | |
| Ambeed | 500g | 3279.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A154211 |
Ethyl 2-(phenylmethoxycarbonylamino)acetate (CAS 1145-81-9) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: ethyl 2-(phenylmethoxycarbonylamino)acetate. InChIKey: HAIHOTOFCDNWDA-UHFFFAOYSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | ethyl 2-(phenylmethoxycarbonylamino)acetate |
| InChIKey | HAIHOTOFCDNWDA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)