cas: 1161-13-3 — see every product listed under this CAS number, including other names
Cbz-Phe-OH 95% (CAS 1161-13-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A193391-5g |
| cas | 1161-13-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 142.31 Pln | |
| Ambeed | 25g | 159.00 Pln | |
| Ambeed | 100g | 236.88 Pln | |
| Ambeed | 500g | 581.75 Pln | |
| Ambeed | 1000g | 1093.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A193391 |
(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 1161-13-3) is a chemical compound with the molecular formula C17H17NO4 and a molecular weight of 299.32 g/mol. IUPAC name: (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: RRONHWAVOYADJL-HNNXBMFYSA-N.
| Molecular formula | C17H17NO4 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | RRONHWAVOYADJL-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)