cas: 637337-65-6 — see every product listed under this CAS number, including other names
Cbz-S-3-Aminoisobutyric acid 98% (CAS 637337-65-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A150931-250mg |
| cas | 637337-65-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 414.88 Pln | |
| Ambeed | 5g | 1638.62 Pln | |
| Ambeed | 10g | 2689.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A150931 |
(2S)-2-methyl-3-(phenylmethoxycarbonylamino)propanoic acid (CAS 637337-65-6) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: (2S)-2-methyl-3-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: YDSJUQJHDFBDSZ-VIFPVBQESA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (2S)-2-methyl-3-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | YDSJUQJHDFBDSZ-VIFPVBQESA-N |
| SMILES | C[C@@H](CNC(=O)OCC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)