Products 1202866-96-3
CAS 1202866-96-3 appears in our catalog under these names: Chalcone 4 hydrate/ 98.72% (existing batch purity), Chalcone 4 hydrate, Chalcone 4 hydrate, Chalcone 4 (hydrate), Chalcone 4 (hydrate), 98.0%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
(E)-1-(4-chlorophenyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one;hydrate (CAS 1202866-96-3) is a chemical compound with the molecular formula C16H15ClO4 and a molecular weight of 306.74 g/mol. IUPAC name: (E)-1-(4-chlorophenyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one;hydrate. InChIKey: PXVQKTVKTBMRIW-VOKCZWNHSA-N.
| Molecular formula | C16H15ClO4 |
|---|---|
| Molecular weight | 306.74 g/mol |
| IUPAC name | (E)-1-(4-chlorophenyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one;hydrate |
| InChIKey | PXVQKTVKTBMRIW-VOKCZWNHSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C/C(=O)C2=CC=C(C=C2)Cl)O.O |
Computed by PubChem (NCBI)