cas: 279261-84-6 — see every product listed under this CAS number, including other names
Chroman-6-ylboronic acid, 97% (CAS 279261-84-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F362202-100MG |
| cas | 279261-84-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 726.85 Pln | |
| Fluorochem | 250mg | 1195.43 Pln | |
| Fluorochem | 1g | 2403.34 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3,4-dihydro-2H-chromen-6-ylboronic acid (CAS 279261-84-6) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: 3,4-dihydro-2H-chromen-6-ylboronic acid. InChIKey: RIBOTMNSYSYOHG-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | 3,4-dihydro-2H-chromen-6-ylboronic acid |
| InChIKey | RIBOTMNSYSYOHG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OCCC2)(O)O |
Computed by PubChem (NCBI)