cas: 279261-84-6 — see every product listed under this CAS number, including other names
Chroman-6-ylboronic acid, 98+%, 98+% (CAS 279261-84-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BF6R-100mg |
| cas | 279261-84-6 |
| size | 100mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1010.00 Pln | |
| Chemat | 250mg | 1643.60 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
3,4-dihydro-2H-chromen-6-ylboronic acid (CAS 279261-84-6) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: 3,4-dihydro-2H-chromen-6-ylboronic acid. InChIKey: RIBOTMNSYSYOHG-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | 3,4-dihydro-2H-chromen-6-ylboronic acid |
| InChIKey | RIBOTMNSYSYOHG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OCCC2)(O)O |
Computed by PubChem (NCBI)