Clopyralid, 98.52%
cas: 1702-17-6 — see every product listed under this CAS number, including other names
Clopyralid, 98.52% (CAS 1702-17-6) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 10 g, 10mM/1mL, 25 g, 50 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W018749-5 g |
| cas | 1702-17-6 |
| size | 5 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 240.74 Pln | |
| MedChemExpress | 10 g | 287.18 Pln | |
| MedChemExpress | 10mM/1mL | 254.68 Pln | |
| MedChemExpress | 25 g | 407.93 Pln | |
| MedChemExpress | 50 g | 505.45 Pln | |
| MedChemExpress | 100 g | 598.33 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.52% |
Clopyralid is an organochlorine pesticide having a 3,6-dichlorinated picolinic acid structure. It has a role as a herbicide. It is a member of pyridines and an organochlorine pesticide. It is functionally related to a picolinic acid.
Source: ChEBI
| Molecular formula | C6H3Cl2NO2 |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 3,6-dichloropyridine-2-carboxylic acid |
| InChIKey | HUBANNPOLNYSAD-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)