cas: 5680-51-3 — see every product listed under this CAS number, including other names
Cyclopropyl(3-nitrophenyl)methanone, 97%, 97% (CAS 5680-51-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EC8Q-50mg |
| cas | 5680-51-3 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 429.20 Pln | |
| Chemat | 100mg | 664.40 Pln | |
| Chemat | 250mg | 875.60 Pln | |
| Chemat | 1g | 1710.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Cyclopropyl-(3-nitrophenyl)methanone (CAS 5680-51-3) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: cyclopropyl-(3-nitrophenyl)methanone. InChIKey: SPBSPZKRZGRRSE-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | cyclopropyl-(3-nitrophenyl)methanone |
| InChIKey | SPBSPZKRZGRRSE-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)