D-Alanine, phenylmethyl ester, hydrochloride (1:1), 98%, 98%
cas: 34404-37-0 — see every product listed under this CAS number, including other names
D-Alanine, phenylmethyl ester, hydrochloride (1:1), 98%, 98% (CAS 34404-37-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12B319-100mg |
| cas | 34404-37-0 |
| size | 100mg |
| availability | 394.9g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 314.00 Pln | |
| Chemat | 10g | 405.20 Pln | |
| Chemat | 25g | 630.80 Pln | |
| Chemat | 50g | 1125.20 Pln | |
| Chemat | 100g | 2042.00 Pln | |
| Chemat | 250g | 4182.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Benzyl (2R)-2-aminopropanoate;hydrochloride (CAS 34404-37-0) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: benzyl (2R)-2-aminopropanoate;hydrochloride. InChIKey: RLMHWGDKMJIEHH-DDWIOCJRSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | benzyl (2R)-2-aminopropanoate;hydrochloride |
| InChIKey | RLMHWGDKMJIEHH-DDWIOCJRSA-N |
| SMILES | C[C@H](C(=O)OCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
Benzyl (2R)-2-aminopropanoate Hydrochloride, D-Alanine benzyl ester hydrochloride, D-Alanine benzyl ester HCl, benzyl (2R)-2-aminopropanoate;hydrochloride, Benzyl (2R)-2-aopropanoate hydrochloride, benzyl D-alaninate hydrochloride, RLMHWGDKMJIEHH-DDWIOCJRSA-N, Benzyl(2R)-2-aminopropanoateHydrochloride, (R)-benzyl 2-aminopropanoate hydrochloride