cas: 5505-63-5 — see every product listed under this CAS number, including other names
D-Mannosamine HCl 98% (CAS 5505-63-5) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A126596-500g |
| cas | 5505-63-5 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 15155.50 Pln | |
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 142.31 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 10g | 620.69 Pln | |
| Ambeed | 25g | 1221.44 Pln | |
| Ambeed | 100g | 3841.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A126596 |
(2S,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal;hydrochloride (CAS 5505-63-5) is a chemical compound with the molecular formula C6H14ClNO5 and a molecular weight of 215.63 g/mol. IUPAC name: (2S,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal;hydrochloride. InChIKey: CBOJBBMQJBVCMW-MVNLRXSJSA-N.
| Molecular formula | C6H14ClNO5 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | (2S,3R,4S,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal;hydrochloride |
| InChIKey | CBOJBBMQJBVCMW-MVNLRXSJSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@@H](C=O)N)O)O)O)O.Cl |
Computed by PubChem (NCBI)