cas: 73913-64-1 — see every product listed under this CAS number, including other names
D-Valine ethyl ester hydrochloride, 97%, 97% (CAS 73913-64-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FB6I-1g |
| cas | 73913-64-1 |
| size | 1g |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 10g | 174.80 Pln | |
| Chemat | 25g | 280.40 Pln | |
| Chemat | 100g | 731.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl (2R)-2-amino-3-methylbutanoate;hydrochloride (CAS 73913-64-1) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: ethyl (2R)-2-amino-3-methylbutanoate;hydrochloride. InChIKey: PQGVTLQEKCJXKF-FYZOBXCZSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | ethyl (2R)-2-amino-3-methylbutanoate;hydrochloride |
| InChIKey | PQGVTLQEKCJXKF-FYZOBXCZSA-N |
| SMILES | CCOC(=O)[C@@H](C(C)C)N.Cl |
Computed by PubChem (NCBI)