Products 92398-54-4

CAS 92398-54-4 is the registry number for 2-Amino-2-ethyl-butanoic acid methyl ester hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2-amino-2-ethylbutanoate;hydrochloride (CAS 92398-54-4) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: methyl 2-amino-2-ethylbutanoate;hydrochloride. InChIKey: BIODDQGVQGOUQK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H16ClNO2
Molecular weight181.66 g/mol
IUPAC namemethyl 2-amino-2-ethylbutanoate;hydrochloride
InChIKeyBIODDQGVQGOUQK-UHFFFAOYSA-N
SMILESCCC(CC)(C(=O)OC)N.Cl

Computed by PubChem (NCBI)